| CAS 登录号 | 产品名称 | 分子式 |
|---|---|---|
| 9049-37-0 | Pectic acid sodium salt;NaPP; Sodium pectate; Sodium polypectate | |
| 9049-93-8 | Amberlyst A 21 | |
| 9049-98-3 | Arlacel A | |
| 9050-04-8 | Carboxymethylcellulose Calcium;Carboxymethyl cellulose | C23H30ClN3O |
| 9050-06-0 | Poly(vinyl cinnamate) | (C11H10O2)n |
| 9050-31-1 | Hydroxypropyl methylcellulose phthalate ;Hydroxypropyl methyl cellulose phthalate | |
| 9050-36-6 | Maltodextrin;MLD | |
| 9050-67-3 | Sizofiran;(2R,3R,4S,5R,6R)-4-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-6-(hydroxymethyl)oxane-2,3,5-triol | C24H42O21 |
| 9050-68-4 | Sephadex G 10 | |
| 9050-94-6 | Sephadex G 100 | |
| 9050-97-9 | Amberlite IRA 900 | |
| 9051-29-0 | alpha-Lactalbumins | |
| 9051-49-4 | Pentaerythritol propoxylate;2,2-Dimethylolpropane-1,3-Diol;3-[3-(3-Hydroxypropoxy)-2,2-Bis(3-Hydroxypropoxymethyl)Propoxy]Propan-1-Ol;Poly(Oxy(Methyl-1,2-Ethanediyl)), Alpha-Hydro-Omega-Hydroxy-, Ether With 2,2-Bis(Hydroxymethyl)-1,3-Propanediol (4:1) | C22H48O12 |
| 9051-97-2 | beta Glucan;Paramylon; (2S,3R,4S,5R,6R)-2-[(2R,3R,4R,5S)-3,5-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxy-4-[(2S,3R,5S,6R)-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-(hydroxymethyl)oxane-3,5-diol | C18H32O14 |
| 9052-45-3 | 2-Propenoic acid polymer with diethenyl benzene;Acrylic Acid;1,2-Divinylbenzene;2-Propenoic Acid, Polymer With Diethenyl Benzene;2-Propenoic Acid, Polymer With Diethenylbenzene | C13H14O2 |
| 9052-95-3 | Divinylbenzene, ethylvinylbenzene, vinylbenzene copolymer;1,2-Divinylbenzene;1-Ethyl-2-Vinyl-Benzene;Styrene;1,2-Divinylbenzene;1-Ethyl-2-Vinylbenzene;Styrene;1,2-Di(Ethenyl)Benzene;Ethenylbenzene;1-Ethenyl-2-Ethyl-Benzene | C28H30 |
| 9054-63-1 | Microsomal aminopeptidase;Alanine aminopeptidase; Alanine-specific aminopeptidase; Alanyl aminopeptidase; Aminopeptidase M; Aminopeptidase M II; Aminopeptidase N; Aminopeptidase N/CD13; Aminopeptidase PepN | |
| 9054-89-1 | Superoxide dismutase;SOD | |
| 9056-59-1 | Amberlite IRA 68;IRA 68 | |
| 9057-02-7 | Pululan;Maltotriose | (C37H62O30)n |
| 9062-07-1 | iota-Carrageenin;SeaSpen PF; Sigma C 1138; Soageena MV 201; Soageena MV 220; Soageena MV 320; Soageena MV 330; TS 150; Vicarin SD 389; Viscarin ME 389; Viscarin SD 309; beta-Carrageenan 2,4'-bis(hydrogen sulfate); iota-Carrageenin | |
| 9063-38-1 | Sodium carboxyl methylstarch;Sodium starch glycolate | |
| 9064-57-7 | lambda-Carrageenan;CS 67; Carrageenan CSL 1; Carravisco DFL 1; Gelamix L; Genugel X 3948; Genuvisco CMS 2; Lactarin MV 306; Lactarin MV 406; Lambda-carrageenan; NL-V; Picnin A; San Support P 30; Sankara 634; Satiagel MM 30; Satiagum UTC 30; Soageena ML 210; Sunkara 1057; Sunkara 634; Supungeru HMV; Viscarin GP 109; Viscarin GP 209; Viscarin GP 209F; Viscarin GP 209NF; Welgeenan ED 1039 | |
| 9064-91-9 | 2-(Diethylamino)ethyl dextran ether hydrochloride;DEAE dextran hydrochloride; Detaxtran; Diethylaminoethyl dextran hydrochloride; Dormacid | |
| 9065-13-8 | Dimethyl hydantoin formaldehyde resin | C6H10N2O3 |
| 9066-59-5 | Lysozyme hydrochloride;Lysozyme chloride; Muramidase hydrolase; Murazyme | |
| 9067-32-7 | Sodium hyaluronate;Hyaluronic acid sodium salt; Chlamyhyaluronic acid sodium salt | (C14H20NO11Na)n |
| 9067-77-0 | Phosphopyruvate carboxylase;Phosphoenolpyruvate carboxylase; Phosphoenolpyruvate carboxylase (phosphate); Phosphoenolpyruvic carboxylase | |
| 9068-38-6 | Reverse transcriptase | |
| 9068-54-6 | Phosphodiesterase II | |
| 9072-19-9 | Fucoidan;Sulfated algal polysaccharide | (C6H10O7S)n |
| 9073-60-3 | beta-Lactamase;Penicillinase; Penicilloyl serine transferase; Carbapenem hydrolase; Carbapenemase; Cefinase; Cefotaximase; Ceftazidimase; Ceftazimidase; Cefuroximase; Cephalosporinase; Cephamycinase | |
| 9073-78-3 | Thermolysin;Bacillus thermoproteolyticus neutral proteinase; E.C. 3.4.24.27; PeptiCLEC-TR; Protealysin; Proteinase, Bacillus thermoproteolyticus neutral; Protex 14L; Protin AC 10F; Thermoase; Thermoase C160; Thermoase PC 10F; Thermoase PS 160; Thermoase Y 10; Thermolysin PC 1012; Thermolysin-like protease; Type-X protease | |
| 9073-95-4 | Phosphogluconate dehydrogenase (NADP, decarboxylating) | |
| 9074-06-0 | Sucrose phosphorylase;E.C. 2.4.1.7 | |
| 9074-98-0 | beta-Glucanase;Promalt 295; Safizym GP 500; Succinoglycan depolymerase; Ultraflow; Viscoflow MG; Xyloglucanofoetidin; ZY 18; beta-D-Glucanase; beta-Glucan hydrolase; beta-Glucan solubilase; beta-Glucan-releasing enzymes; beta-Glucosanase | |
| 9075-21-2 | Pyroglutamate aminopeptidase;L-Pyrrolidonecarboxylate peptidase; L-Pyrrolidonyl aminopeptidase; Pyroglutamate aminopeptidase I; Pyroglutamate arylamidase; Pyroglutamic acid aminopeptidase; Pyroglutamic acid arylamidase; Pyroglutamidase; Pyroglutamyl aminopeptidase; Pyroglutamyl aminopeptidase I; Pyroglutamyl peptidase; Pyroglutamyl peptidase I; Pyrrolidonecarboxy peptidase; Pyrrolidonecarboxylate peptidase; Pyrrolidonyl peptidase; TRH-degrading serum enzyme | |
| 9076-44-2 | Chymostatin;(2S)-2-[[(1S)-1-(2-Amino-3,4,5,6-tetrahydropyrimidin-4-yl)-2-[[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]pentan-2-yl]amino]-2-oxoethyl]carbamoylamino]-3-phenylpropanoic acid | C31H41N7O6 |
| 9080-67-5 | 1-Chloro-4-vinylbenzene;1-Chloro-4-ethenyl-benzene;1-Chloro-4-vinylbenzene #;Benzene, 4-chloro-1-ethenyl- | C8H7Cl |
| 9080-79-9 | Sodium Carbonate Stabilized Sulfonated Polystyrene Sodium Salt | |
| 9082-00-2 | Glycerol ethoxylated propoxylated;Glycerol polyethylene-propylene glycol ether | C3H8O3.3(C2H4O)n.3(C3H6O)x |
| 9082-07-9 | Chondroitin sulfate sodium salt;Sodium (beta-Glucuronic acid-(1-3)N-acetyl-beta-galactosamine-4-sulfate | C14H22NNaO15S |
| 9082-71-7 | Dehydrogenase, Leucine | |
| 9087-69-8 | Haptoglobin;Haptoglobins; Haptoglobins, complexes; Complexes haptoglobins; Haptoglobin complex; Hp (hepatoglobin) | |
| 9087-70-1 | Aprotinin;Trypsin Inhibitor | C284H432N84O79S7 |
| 10001-35-1 | 2,3-Dihydro-6,7-dimethoxy-1,4-phthalazinedione | C10H10N2O4 |
| 10002-29-6 | 2-(2-Pyridylsulfanyl)acetic acid;(2-Pyridylthio)acetic acid; (Pyridin-2-ylsulfanyl)acetic acid | C7H7NO2S |
| 10004-44-1 | Hymexazol;3-Hydroxy-5-methylisoxazole; 5-Methyl-3(2H)-isoxazolone | C4H5NO2 |
| 10006-74-3 | 3-Ethoxy-2-pyridinylamine;2-Amino-3-ethoxypyridine | C7H10N2O |
| 10008-73-8 | Dihydro-5-Methylene-2(3H)-Furanone;5-Methylenetetrahydrofuran-2-One;5-Methylene-2-Tetrahydrofuranone;Chebi:36439 | C5H6O2 |