全球化学品在线数据库
| CAS 登录号 | 产品名称 | 分子式 |
|---|---|---|
| 623-65-4 | Palmitic anhydride;Hexadecanoic anhydride | C32H62O3 |
| 623-66-5 | Octanoic anhydride;n-Octanoic anhydride | C16H30O3 |
| 623-68-7 | Crotonic anhydride;2-Butenoic anhydride | C8H10O3 |
| 623-69-8 | 1,3-Dimethoxy-2-propanol | C5H12O3 |
| 623-70-1 | Ethyl crotonate;Ethyl 2-butenoate; Ethyl (E)-2-butenoate | C6H10O2 |
| 623-71-2 | Ethyl 3-chloropropionate | C5H9ClO2 |
| 623-72-3 | 3-Hydroxypropanoic acid ethyl ester;Ethyl 3-hydroxypropanoate; Ethyl 3-hydroxypropionate | C5H10O3 |
| 623-73-4 | Ethyl diazoacetate;Ethyl 2-diazoacetate | C4H6N2O2 |
| 623-76-7 | 1,3-Diethylurea | C5H12N2O |
| 623-78-9 | Ethyl N-Ethylcarbamate;N-Ethylcarbamic Acid Ethyl Ester;N-Ethylurethane;Nsc440 | C5H11NO2 |
| 623-80-3 | Dithiocarbonic Acid S,S'-Diethyl Ester;Bis(Ethylthio)Methanone;Carbonodithioic Acid, S,S-Diethyl Ester;S,S-Diethyl Carbamodithioate | C5H10OS2 |
| 623-81-4 | Diethyl sulfite;DES | C4H10O3S |
| 623-82-5 | (+)-3-Methylhexanedioic Acid;(3R)-3-Methyladipate;Zinc01589760 | C7H10O4 |
| 623-84-7 | Propylene glycol diacetate;1,2-Propyleneglycol diacetate | C7H12O4 |
| 623-85-8 | N-Propylurethane;N-Propylcarbamic Acid Ethyl Ester;Nsc 35829;4-04-00-00480 (Beilstein Handbook Reference) | C6H13NO2 |
| 623-91-6 | Diethyl fumarate ;(E)-2-Butenedioic acid diethyl ester | C8H12O4 |
| 623-93-8 | 5-Nonanol;Ai3-04244;Dibutyl Carbinol | C9H20O |
| 623-95-0 | 1,3-Dipropylurea;N,N'-Dipropylurea | C7H16N2O |
| 623-96-1 | Dipropyl carbonate;Carbonic acid dipropyl ester | C7H14O3 |
| 623-97-2 | Pentaerythrityl Tetrabromide;Propanoic Acid, 3-Chloro-, 2-Chloroethyl Ester;Tl 259;2-Chloroethyl Carbonate | C5H8Cl2O3 |
| 623-98-3 | Dipropyl Sulfite;Dipropyl Sulfite;Zinc02522811;Di-N-Propyl Sulphite | C6H14O3S |
| 624-01-1 | 5-Oxodecanoic Acid;5-Ketocapric Acid;5-Oxo Capric Acid;5-Oxo-Decanoic Acid | C10H18O3 |
| 624-03-3 | Ethane-1,2-Diyl Palmitate;Hexadecanoic Acid 2-(1-Oxohexadecoxy)Ethyl Ester;Palmitic Acid 2-Hexadecanoyloxyethyl Ester;1,2-Di-O-Hexadecanoylethanediol | C34H66O4 |
| 624-04-4 | Ethylene Glycol Dilaurate;Dodecanoic Acid 2-(1-Oxododecoxy)Ethyl Ester;Lauric Acid 2-Lauroyloxyethyl Ester;Ai3-03485 | C26H50O4 |
| 624-08-8 | 9-Heptadecanol | C17H36O |
| 624-09-9 | Heptyl Heptanoate;Heptanoic Acid Heptyl Ester;Enanthic Acid Heptyl Ester;Ai3-02076 | C14H28O2 |
| 624-10-2 | Bis(2-Ethoxyethyl) Sebacate;Decanedioic Acid Bis(2-Ethoxyethyl) Ester;Sebacic Acid Bis(2-Ethoxyethyl) Ester;Ai3-01357 | C18H34O6 |
| 624-13-5 | Propyl octanoate;Octanoic acid propyl ester; Propyl caprylate | C11H22O2 |
| 624-16-8 | 4-Decanone;Hexyl Propyl Ketone;4-Decanone;Decan-1-Oyl Chloride | C10H20O |
| 624-17-9 | Azelaic acid diethyl ester;Nonanedioic acid diethyl ester; Diethyl azelaate; Diethyl azelate; Diethyl nonanedioate; NSC 61074 | C13H24O4 |
| 624-18-0 | 1,4-Diaminobenzene dihydrochloride;1,4-Benzenediamine dihydrochloride; 4-Aminoaniline dihydrochloride; p-Phenylenediamine dihydrochloride; C.I. 76061 | C6H8N2.2(HCl) |
| 624-22-6 | 2-Methylhexanol | C7H16O |
| 624-24-8 | Valeric acid methyl ester;4-Methylbutanoic acid methyl ester; Methyl n-valerate; Methyl pentanoate; Methyl valerate; Methyl valerianate | C6H12O2 |
| 624-28-2 | 2,5-Dibromopyridine | C5H3Br2N |
| 624-29-3 | cis-1,4-Dimethylcyclohexane;Nsc 44845;Inchi=1/C8h16/C1-7-3-5-8(2)6-4-7/H7-8H,3-6H2,1-2H3/T7-,8;1,4-Dimethylcyclohexane, Mixture Of Cis And Trans | C8H16 |
| 624-31-7 | 4-Iodotoluene;1-Iodo-4-methylbenzene; p-Iodotoluene | C7H7I |
| 624-38-4 | 1,4-Diiodobenzene;p-Diiodobenzene | C6H4I2 |
| 624-39-5 | 1,4-Benzenedithiol | C6H6S2 |
| 624-41-9 | 2-Methylbutyl acetate | C7H14O2 |
| 624-44-2 | 5-Methyl-2-Hexanone Oxime;5-Methylhexan-2-One Oxime;0-01-00-00701 (Beilstein Handbook Reference);2-Hexanone, 5-Methyl-, Oxime | C7H15NO |
| 624-45-3 | Methyl levulinate;4-Oxovaleric acid methyl ester; Methyl 4-oxovalerate | C6H10O3 |
| 624-48-6 | Dimethyl maleate | C6H8O4 |
| 624-49-7 | Dimethyl fumarate;(E)-2-Butenedioic acid dimethyl ester | C6H8O4 |
| 624-51-1 | 3-Nonanol;Hexylethylcarbinol;3-Nonanol;Ai3-37211 | C9H20O |
| 624-54-4 | Pentyl propionate;n-Amyl propionate | C8H16O2 |
| 624-57-7 | (Iodomethyl)Oxirane;1-Iodo-2,3-Epoxypropane;(Iodomethyl)Oxirane;Epiiodohydrin | C3H5IO |
| 624-58-8 | Oxiraneacetonitrile;2-(Oxiran-2-yl)acetonitrile | C4H5NO |
| 624-60-2 | N-Methylethylamine hydrochloride | C3H9N.HCl |
| 624-64-6 | (2E)-2-Butene;B 7;Budium Rk 622;Butadiene Homopolymer | C4H8 |
| 624-65-7 | 3-Chloropropyne;3-Chloro-1-propyne; Propargyl chloride | C3H3Cl |