Online Database of Chemicals from Around the World
|
CAS#: 93842-98-9 Product: 2-(2,4-Dichlorophenyl)-2-Oxoacetamide No suppilers available for the product. |
| Name | 2-(2,4-Dichlorophenyl)-2-Oxoacetamide |
|---|---|
| Synonyms | 2-(2,4-Dichlorophenyl)-2-Oxo-Acetamide; 2-(2,4-Dichlorophenyl)-2-Keto-Acetamide; 2-(2,4-Dichlorophenyl)-2-Oxo-Ethanamide |
| Molecular Structure |  |
| Molecular Formula | C8H5Cl2NO2 |
| Molecular Weight | 218.04 |
| CAS Registry Number | 93842-98-9 |
| EINECS | 299-075-2 |
| SMILES | C1=C(Cl)C=CC(=C1Cl)C(=O)C(=O)N |
| InChI | 1S/C8H5Cl2NO2/c9-4-1-2-5(6(10)3-4)7(12)8(11)13/h1-3H,(H2,11,13) |
| InChIKey | KZURMKZAGBRHQM-UHFFFAOYSA-N |
| Density | 1.497g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.624°C at 760 mmHg (Cal.) |
| Flash point | 187.624°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4-Dichlorophenyl)-2-Oxoacetamide |