Online Database of Chemicals from Around the World
5,7-Dichloro-2-trityl-1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid
[CAS# 1194550-56-5]
Identification| Name | 5,7-Dichloro-2-trityl-1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C29H23Cl2NO2 |
| Molecular Weight | 488.40 |
| CAS Registry Number | 1194550-56-5 |
| SMILES | C1CN(CC2=CC(=C(C(=C21)Cl)C(=O)O)Cl)C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5 |
|
Properties
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.660, Calc.* |
| Boiling Point | 598.2±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 315.6±30.1 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
Dichlorotriphen... Dichlorotriphen... Dichlorotriphen... Dichlorotris(he... Dichloro[tris(2... Dichloro[tris(2... Dichloro[Tris(P... Dichlorotris(1,... Dichloro-Tris(2... Dichloro-Tris[4... 3,5-Dichloro-L-... 1,2-Dichloround... 10,11-Dichloro-... Dichlorouranium... N,N-Dichloroure... 2',4'-Dichlorov... 5,6-Dichlorovan... S-1,2-Dichlorov... 1,3-Dichloro-5-... (1,2-Dichlorovi...