Online Database of Chemicals from Around the World
| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 9005-70-3 | Tween 85;Polyethylene glycol sorbitan trioleate; Polyoxyethylene sorbitan trioleate; Polysorbate 85 | C60H108O8.(C2H4O)n |
| 9005-71-4 | Tween 65;Ahco 7166T; E 436; Emsorb 6907; Ethoxylated sorbitan tristearate; Glycosperse TS 20; Komul NP 4; Liposorb TS 20; Montanox 65; Nikkol TS 30; POE sorbitan tristearate; Poly(oxyethylene) sorbitan tristearate; Polyethylene glycol sorbitan ether tristearate; Polyethylene glycol sorbitan tristearate; Polyethylene glycol sorbitan tristearate ether; Polyoxyethylene 20 sorbitan tristearate; Polysorbate 65; Rheodol TW-S 320; Rheodol TW-S 320V; Sorbimacrogol tristearate 300; Sorgen TW 65; T 65; T-MAZ 65K; TS 30V | |
| 9005-79-2 | Glycogen;(2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6R)-4,5-dihydroxy-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | C24H42O21 |
| 9005-80-5 | Inulin | C12H22O11.C6H12O6 |
| 9005-82-7 | Amylose;Amylose from potato | (C6H10O5)n |
| 9005-84-9 | Starch soluble;Amylodextrin | (C6H10O5)n |
| 9006-42-2 | Metiram;Amarex; Carbatene; Metiram-zinc; NIA 9102; Phytox-Super; Polycarbacin; Polycarbacine; Polycarbazin; Polycarbazine; Polykarbacin; Polymarcin; Polymarcine; Polymarsin; Polymarzin; Polymarzine; Polymat; Polyram 2000; Polyram 80; Polyram 80WP; Polyram DF; Polyram combi | |
| 9006-59-1 | Ovalbumin;Egg albumins; Albumin from chicken egg; Protalbinic acid | |
| 9006-65-9 | Dimethicone;Polydimethylsiloxane trimethylsiloxy-terminated | C3H9OSi.(C2H6OSi)n.C3H9Si |
| 9007-16-3 | 2-Methylbutanoic acid | C5H10O2 |
| 9007-20-9 | Carbomer;Carbopol | (C3H4O2)n |
| 9007-28-7 | Chondroitin sulfate ;Poly-1(2/3)-N-acetyl-2-amino-2-deoxy-3-O-beta-D-glucopyranurosyl-4-(6)sulfonyl-D-galactose | (C14H21NO14S)n |
| 9007-34-5 | Collagens polypeptide;L-Lysyl-L-prolylglycyl-L-alpha-glutamyl-L-prolylglycyl-L-prolyl-L-lysine | C25H48N4O5 |
| 9007-43-6 | Cytochrome C | C42H54FeN8O6S2 |
| 9007-49-2 | Deoxyribonucleic acid;Deoxyribonucleic acids | |
| 9007-58-3 | Elastins;Elastin; E 91; E 91 (elastin) | |
| 9007-83-4 | gamma-Globulins;Blood gamma-globulin; Blood plasma gamma-globulins | |
| 9007-92-5 | Glucagon | |
| 9008-02-0 | Hemoglobins;Blood pigments; Hemoglobin; Deoxyhemoglobins; Ferrohemoglobins; Hemoglobin human | |
| 9008-12-2 | Intrinsic factors;Intrinsic factor; Castle's factor; Castle's gastric factor; Castle's hemopoietic factor; Castle's intrinsic factors; Chromoproteins, intrinsic factors; Gastric intrinsic factor; Intrinsic factors, Castle's; Proteins, specific or class, intrinsic factors | |
| 9008-22-4 | Laminaran;Goemar H 11; Iodus 40; Laminarin | |
| 9008-30-4 | Lysophosphatidylcholines;Phospholipids, lysophosphatidylcholines; QPFC-LC 100; SLP White Lyso; SLP-LPC 70; SLP-Pastelyso; Sunsoft A 1 | |
| 9008-42-8 | Strong protein silver;Albumose silver; Poviargol; Proganol; Protargentum; Protargol; Strong protargin | |
| 9009-65-8 | Protamines sulfates | |
| 9010-34-8 | Thyroglobulin;Thyroglobulins; Elityran; Globulins, thyro; Proloid; Thyractin; Thyroid globulin | |
| 9010-66-6 | Zein | |
| 9010-98-4 | Polychloroprene;Chloroprene rubber; 2-Chloro-1,3-butadiene homopolymer | (C4H5Cl)n |
| 9011-13-6 | Maleic acid anhydride-styrene copolymer;Xiran SZ 28065; Xiran SZ 28110; Xiran XZ 09-002; Xiran XZ 09-004; Zelan 338 | (C8H8)x.(C4H2O3)x |
| 9011-14-7 | Methacrylic acid methyl ester polymers;Zimmer Bone Cement; Zimmer DT; Zimmer Dough Type; Zimmer LVC; Zimmer Low Viscosity | (C5H8O2)x |
| 9011-16-9 | Poly(methyl vinyl ether-alt-maleic anhydride) | (C4H2O3)n.(C3H6O)n |
| 9011-17-0 | 1,1-Difluoroethylene-perfluoropropene copolymer | (C3F6)x.(C2H2F2)x |
| 9011-18-1 | Dextran sulfate sodium | (C6H7Na3O14S3)n |
| 9011-93-2 | Lysostaphin endopeptidase;Ambicin L; E.C. 3.4.24.75; EC 3.4.24.75; Glycyl-glycine endopeptidase | |
| 9012-36-6 | Agarose;3,6-Anhydro-alpha-L-galacto-beta-D-galactan; Reacti-Gel; Sepharose | |
| 9012-37-7 | Aminoacylase;Acylase; Acylase 1500 Amano; Acylase I; Amino acid deacylase; Aminoacylase 1; Aminoacylase I; Benzamidase; Dehydropeptidase II; E.C. 3.5.1.14; Hippurase; Hippuricase; Histozyme; L-Amino acid acylase; L-Aminoacylase; N-Acyl-L-amino acid amidohydrolase | |
| 9012-54-8 | Cellulase;1,4-beta-D-Endoglucanase; 1,4-beta-D-Glucan 4-glucanohydrolase; 1,4-beta-D-Glucan endoglucanase; 1,4-beta-Glycanase; 800NSK; ACE 70; ACLA; AE 202; AUS 0301; Accel Forte H; Accellerase | |
| 9012-63-9 | Cholera toxin;Choleragen; Choleragenoid | |
| 9012-69-5 | Phosphorylase b;Dephosphophosphorylase; Glycogen phosphorylase b | |
| 9012-72-0 | beta-(1,3)-D-Glucan | (C18H30O14)n |
| 9012-76-4 | Chitosan;Poly(beta-(1,4)-2-amino-2-deoxy-D-glucose); Poly(beta-(1,4)-D-glucosamine) | (C6H11NO4)n |
| 9012-90-2 | DNA polymerase | |
| 9013-02-9 | Myokinase;5'-AMP kinase; AMP kinase; Adenylate kinase 2; Adenylate kinase 3; Adenylic kinase; Adenylokinase; E.C. 2.7.4.3; Adenylate kinase | |
| 9013-18-7 | Acyl-coenzyme A synthetase;3-Hydroxyacyl-CoA synthase; Acyl CoA synthetase; Acyl coenzyme A synthetase; Acyl-CoA ligase; Acyl-CoA synthase; Acyl-coenzyme A ligase; E.C. 6.2.1.3; Fatty acid CoA ligase; Fatty acid thiokinase; Fatty acid thiokinase (long chain); Fatty acyl CoA synthetase; Fatty acyl-CoA ligase; Fatty acyl-coenzyme A synthetase; Hexanoyl coenzyme A synthetase; Hexanoyl-CoA synthetase | |
| 9013-20-1 | Streptavidin;Polystreptavidin | |
| 9013-34-7 | 2-(Diethylamino)ethyl cellulose;Cellulose diethylaminoethyl ether; Cellulose, N,N-diethylaminoethyl ether; DE 22; DE 23; DE 32; DE 32 (ion exchanger); DE 51; DE 52; DE 53; DEAE 52; DEAE-Cellulose DE-22 | |
| 9013-66-5 | Glutathione peroxidase;E.C. 1.11.1.9; EC 1.11.1.9; GSH peroxidase; Glutathione sulfhydryl peroxidase; Peroxynitrite reductase; Reduced glutathione peroxidase | |
| 9013-95-0 | Levan;Gum levan; Gums, Pseudomonas; Levans | |
| 9014-00-0 | Luciferase;1: PN: CN103239735 FIGURE: 4A claimed sequence; Alkanal monooxygenase (FMN-linked); Bacteria luciferase; Bacterial luciferase; E.C. 1.14.14.3; Luciferase (Photobacterium leiognathi); Photorhabdus luminescens luciferase; Vibrio fischeri luciferase; Vibrio harveyi luciferase | |
| 9014-01-1 | Subtilisin;Savinase 32.0 L-EX; Savinase 4.0T; Savinase 4T; Savinase 6T; Savinase 8.0; Savinase 8.0L; Savinase 8.0T; Savinase L16 EX; Savinase TM; Savinase Ultra 16L; Serine alkaline protease; Spezyme FAN; Subtilisin Carlsberg; Subtilisin DFE; Subtilisin KL; Subtilopeptidase; Sumizyme CP; Superase; Thermoase PC 10; Tricozyme ML 3; Validase TSP Concentrate II; YN-NL Amano | |
| 9014-06-6 | Penicillin amidase;Penicillin V amidase; Penicillin acylase; Penicillin amidohydrolase; Phenoxymethylpenicillin amidohydrolase; Semacylase; alpha-Acylamino-beta-lactam acylhydrolase; beta-Lactam acylase |