Online Database of Chemicals from Around the World
| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 638-02-8 | 2,5-Dimethylthiophene | C6H8S |
| 638-03-9 | m-Toluidine Hydrochloride;M-Toluidine Hydrochloride;Aniline,3-Methyl-, Hydrochloride;M-Toluidine.Hcl | C7H10ClN |
| 638-04-0 | cis-1,3-Dimethylcyclohexane;118362_Aldrich;1,Cis-3-Dimethylcyclohexane;Cyclohexane, 1,3-Dimethyl-, Cis- | C8H16 |
| 638-07-3 | Ethyl 4-chloroacetoacetate;Ethyl 4-chloro-3-oxobutanoate | C6H9ClO3 |
| 638-08-4 | Stearic Anhydride;Octadecanoic Acid 1-Oxooctadecyl Ester;Stearic Acid Stearoyl Ester;S5128_Sial | C36H70O3 |
| 638-09-5 | 1,3,5-Benzenetriamine trihydrochloride | C6H9N3.3(HCl) |
| 638-10-8 | Ethyl 3,3-dimethylacrylate;Ethyl senecioate; 3-Methyl-2-butenoic acid ethyl ester; Ethyl 3-methylcrotonate | C7H12O2 |
| 638-11-9 | Isopropyl butanoate;2-Propyl butanoate; Butanoic acid isopropyl ester; 1-Methylethyl butanoate; Isopropyl butyrate; Isopropyl n-butyrate | C7H14O2 |
| 638-16-4 | Trithiocyanuric acid;1,3,5-Triazine-2,4,6-trithiol; s-Triazine-2,4,6-trithiol | C3H3N3S3 |
| 638-18-6 | 3-Hydroxyglutaric Acid;3-Hydroxyglutaric Acid;3Hg | C5H8O5 |
| 638-21-1 | Phenyl phosphine;Phosphaniline | C6H7P |
| 638-23-3 | S-Carboxymethyl-L-cysteine ;3-Carboxymethylthio-L-alanine; Carbocysteine | C5H9NO4S |
| 638-25-5 | FEMA 2079 | |
| 638-26-6 | 10-Hydroxystearic Acid;(10R)-10-Hydroxystearic Acid;(R)-10-Hydroxystearate;C03195 | C18H36O3 |
| 638-27-7 | Isoamylisocyanide;Γ-Methylbutyl Isocyanide;Isoamyl Carbylamine;ISOAMYLISOCYANIDE | C6H11N |
| 638-28-8 | 2-Chlorohexane;Hexane, 2-Chloro-;Inchi=1/C6h13cl/C1-3-4-5-6(2)7/H6h,3-5H2,1-2H | C6H13Cl |
| 638-29-9 | Valeryl chloride | C5H9ClO |
| 638-32-4 | Succinamic Acid;4-Amino-4-Oxobut-2-Ynoic Acid;4-Amino-4-Oxo-Butanoic Acid;4-Amino-4-Oxo-But-2-Ynoic Acid | C4H7NO3 |
| 638-36-8 | Phytane;Phytane;Hexadecane, 2,6,10,14-Tetramethyl- | C20H42 |
| 638-38-0 | Manganese(II) acetate;Manganous acetate | Mn(C2H3O2)2 |
| 638-39-1 | Tin(II) acetate | C4H6O4Sn |
| 638-41-5 | Pentyl chloroformate | C6H11ClO2 |
| 638-45-9 | 1-Iodohexane;Hexyl iodide | C6H13I |
| 638-46-0 | n-Butyl Ethyl Sulfide;1-(Ethylthio)Butane;Zinc01555231;2-(Ethylthio)Butane | C6H14S |
| 638-49-3 | Pentyl formate;Amyl formate; NSC 72023; n-Amyl formate; n-Pentyl formate | C6H12O2 |
| 638-51-7 | Hexyl Nitrite;Nitrous Acid Hexyl Ester;Nitrous Acid, Hexyl Ester;N-Hexyl Nitrite | C6H13NO2 |
| 638-53-9 | Tridecanoic acid;NSC 25955; NSC 69131; Tridecylic acid; n-Tridecanoic acid | C13H26O2 |
| 638-54-0 | Octanedial;Suberaldehyde | C8H14O2 |
| 638-56-2 | Tetraethylene glycol dichloride;Diethylene glycol bis(2-chloroethyl) ether; NSC 39639; Tetraethylene glycol dichloride; beta,beta'-Di(beta-chloroethoxy)diethyl ether | C8H16Cl2O3 |
| 638-58-4 | n-Tetradecanamide;Myristamide;St5409335;Myristic Acid Amide | C14H29NO |
| 638-59-5 | Myristyl acetate | C16H32O2 |
| 638-65-3 | Stearonitrile;Stearonitrile;122580_Aldrich;Ai3-14660 | C18H35N |
| 638-66-4 | Stearaldehyde;Stearaldehyde;Stearyl Aldehyde;N-Octadecanal | C18H36O |
| 638-67-5 | n-Tricosane | C23H48 |
| 638-68-6 | Triacontane;NSC 158661; n-Triacontane | C30H62 |
| 638-79-9 | 1-Iodoperfluoropentane;1,1,1,2,2,3,3,4,4,5,5-Undecafluoro-5-iodopentane | C5F11I |
| 638-94-8 | Desonide;(11b,16a)-11,21-Dihydroxy-16,17-((1-methylethylidene)bis(oxy))-pregna-1,4-diene-3,20-dione | C24H32O6 |
| 638-95-9 | alpha-Amyrin;Urs-12-en-3beta-ol; Viminalol | C30H50O |
| 639-58-7 | Chlorotriphenyltin;Triphenyltin chloride; Chlorotriphenylstannane; Fentin chloride | C18H15ClSn |
| 639-81-6 | Ergotaminine;Isoergotamine | C33H35N5O5 |
| 639-97-4 | D-Apiose;2,3,4-Trihydroxy-3-(hydroxymethyl)butanal | C5H10O5 |
| 640-19-7 | 2-Fluoroacetamide;Fluoroacetic acid amide; Flutritex 1; Fussol; Megatox; Monofluoroacetamide; NSC 31876; alpha-Fluoroacetamide | C2H4FNO |
| 640-57-3 | Phenyl p-Tolyl Sulfone;1-Methyl-4-Phenylsulfonyl-Benzene;4Meph-So2-Ph;Aids-005752 | C13H12O2S |
| 640-60-8 | p-Toluenesulfonic Acid Phenyl Ester;4-Methylbenzenesulfonic Acid Phenyl Ester;Nsc14917;Zinc01706217 | C13H12O3S |
| 640-61-9 | N-Methyl-p-toluenesulfonamide;N,4-dimethyl-benzenesulfonamide | C8H11NO2S |
| 640-67-5 | Manganese Oxalate;Manganous Oxalate;Ethanedioate;Manganese(+2) Cation | C2MnO4 |
| 640-68-6 | D-Valine;D-2-Amino-3-methylbutyric acid; Val | C5H11NO2 |
| 640-79-9 | 3alpha,7alpha-Dihydroxy-N-(carboxymethyl)-5beta-cholan-24-amide | C26H43NO5 |
| 640-87-9 | 17-Hydroxy-21-acetoxyprogesterone;Cortodoxon 21-acetate; NSC 81196; Reichstein substance S 21-acetate | C23H32O5 |
| 641-12-3 | Sennidin A;1',1,8',8-Tetrahydroxy-10,10'-dihydroanthrone-3,3'-dicarboxylic acid | C30H18O10 |