| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 68123-30-8 | 2,3-Dihydroxanthotoxol | C11H8O4 |
| 68123-31-9 | Benzofuran-3,6,7-Triol Triacetate | C14H12O7 |
| 68123-32-0 | 2,3-Dihydrobenzofuran-6,7-Diol Diacetate | C12H12O5 |
| 68123-33-1 | N-Succinimidyl 4-Nitrophenylacetate | C12H10N2O6 |
| 68123-40-0 | 1-Allyl-1,1-Dimethyl-2-Stearoylhydrazide Hydrochloride | C23H47ClN2O |
| 68123-41-1 | 2-(2-Anilinovinyl)-3-(2-Carboxyethyl)Benzoxazolium Bromide | C18H17BrN2O3 |
| 68123-42-2 | 3-Carboxyethyl-2-Methylbenzoxazolium Bromide | C11H12BrNO3 |
| 68123-46-6 | Tetracesium 4,4'-Carbonylbisphthalate | C17H6Cs4O9 |
| 68123-47-7 | Tetrarubidium 4,4'-Carbonylbisphthalate | C17H6O9Rb4 |
| 68123-48-8 | Tetrasodium 4,4'-Carbonylbisphthalate | C17H6Na4O9 |
| 68123-49-9 | 1,1'-[[[2-(3-Chloro-2-Hydroxypropoxy)Phenyl]Methylene]Bis(4,1-Phenyleneoxy)]Bis[3-Chloropropan-2-Ol] | C28H31Cl3O6 |
| 68123-53-5 | 2-Methyl-2-Propenoic Acid 2-Ethylhexyl Ester Polymer With Ethenylbenzene, 2-Hydroxyethyl 2-Propenoate, 2-Methylpropyl 2-Methyl-2-Propenoate And 2-Propenoic Acid | C36H56O9 |
| 68123-57-9 | 2-Methyl-2-Propenoic Acid Butyl Ester Polymer With Butyl 2-Propenoate, Ethenylbenzene, 2-Hydroxyethyl 2-Propenoate And 2-Propenoic Acid | C31H46O9 |
| 68124-04-9 | Chonglou Saponin VII | C51H82O21 |
| 68124-64-1 | Tetrabutylammonium phthalate | 2(C16H36N).C8H4O4 |
| 68124-68-5 | Trimethyl[2-[[Oxido[(2-Pentadecyl-1,3-Dioxolan-4-Yl)Methoxy]Phosphinyl]Oxy]Ethyl]Ammonium | C24H50NO6P |
| 68127-19-5 | Spirostan | C39H62O13 |
| 68127-22-0 | (-)-Menthyl (+)-2-pyrrolidone-5-carboxylate | C15H25NO3 |
| 68127-33-3 | 5-Carboxy-4-Hexyl-2-Cyclohexene-1-Octanoicacid Potassium Salt (1:?) | C21H35KO4 |
| 68127-59-3 | (Z)-(1RS,3RS)-3-(2-Chloro-3,3,3-Trifluoropropenyl)-2,2-Dimethylcyclopropanecarboxylic Acid | C9H10ClF3O2 |
| 68127-80-0 | (3-Phenoxyphenyl)Methyl (1S,3R)-3-[(Z)-2-Chloro-3,3,3-Trifluoro-Prop-1 -Enyl]-2,2-Dimethyl-Cyclopropane-1-Carboxylate | C22H20ClF3O3 |
| 68128-25-6 | ((Chloromethyl)Phenylethyl)Trimethoxysilane | C12H19ClO3Si |
| 68128-53-0 | Amylostatin XG | C19H33NO13 |
| 68128-59-6 | 4-(Octadecylamino)-4-oxosulfobutanoic acid diammonium salt | C22H43NO6S.2(NH3) |
| 68128-94-9 | ForMyltetrathiafulvalene | |
| 68129-81-7 | Vetiverol | C15H24O |
| 68130-12-1 / 10377-81-8 | Ethanolamine borate | C2H8BNO3 |
| 68130-14-3 | Acetylated distarch phosphate | C2H4O2.x(H3PO4).x(C6H10O5) |
| 68130-18-7 | Vanadiumhydroxideoxidephosphate | H5O14PV6 |
| 68130-20-1 | Starch phthalate | |
| 68130-24-5 | Decanoic Acid, Ester With 2,2'-[Oxybis(Methylene)]Bis[2-(Hydroxymethyl)-1,3-Propanediol] Octanoate Pentanoate | C33H68O13 |
| 68130-25-6 | Decanoic Acid, Ester With 2,2-Bis(Hydroxymethyl)-1,3-Propanediol 2-Ethylhexanoate Octanoate | C30H62O10 |
| 68130-26-7 | Pentaerythritol Ester Of Heptanoic, Caprylic, And Capric Acids | C30H62O10 |
| 68130-33-6 | Hexanedioic Acid, Polymer With 2,2-Bis(Hydroxymethyl)-1,3-Propanediol, (9Z)-9-Octadecenoate | C29H54O9 |
| 68130-34-7 | Hexanedioic Acid, Polymer With 2,2-Bis(Hydroxymethyl)-1,3-Propanediol, Octadecanoate | C29H58O10 |
| 68130-36-9 | Molybdenum Nickel Hydroxide Oxide Phosphate | HMoNiO6P |
| 68130-37-0 | Cobalt Molybdenum Hydroxide Oxide Phosphate | CoHMoO6P |
| 68130-38-1 | Ammonium Trisodium Divanadate | H4NNa3O22V8 |
| 68130-47-2 | C8-10-Alkyl Alcohols ethoxylated phosphates | |
| 68130-52-9 | Decanoic Acid, Mixed Esters With Hexanoic Acid, Octanoic Acid And Trimethylolpropane | C30H62O9 |
| 68130-55-2 | Hexanedioic acid, mixed esters with decanoic acid, heptanoic acid, octanoic acid and pentaerythritol | |
| 68130-56-3 | Formaldehyde, Polymer With 6-Phenyl-1,3,5-Triazine-2,4-Diamine, Methylated | C10H11N5O |
| 68130-60-9 | 2-Methyl-2-propenoic acid polymer with ethenylbenzene ethyl 2-propenoate and N-(hydroxymethyl)-2-propenamide butylated | |
| 68130-62-1 | 2-Propenamide, Polymer With Ethenylbenzene, Ethyl 2-Propenoate And Formaldehyde, Butylated | C17H23NO4 |
| 68130-75-6 | Phosphoric acid, C14-18 and C16-18-unsatd. alkyl esters, sodium salts | |
| 68130-98-3 / 68130-99-4 | Aziridine, Homopolymer, Ethoxylated, Phosphonomethylated | C2H5N |
| 68131-04-4 | Humic acid sodium salt | |
| 68131-32-8 | Fermented spent sulfite liquor | |
| 68131-37-3 | Hydrolyzed starch syrups, dehydrated | |
| 68131-39-5 | Alcohols, C12-15, Ethoxylated |